C30H36F3NO5 — CID 67196644
[(2S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67196644) has the molecular formula C30H36F3NO5 and a molecular weight of 547.61 g/mol. Its IUPAC name is [(2S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(2S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67196644 |
| Molecular Formula | C30H36F3NO5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | [(2S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | CCCCCC#CC[N+]1(C)CCC[C@H]1COC(=O)C(O)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H36NO3.C2HF3O2/c1-3-4-5-6-7-14-21-29(2)22-15-20-26(29)23-32-27(30)28(31,24-16-10-8-11-17-24)25-18-12-9-13-19-25;3-2(4,5)1(6)7/h8-13,16-19,26,31H,3-6,15,20-23H2,1-2H3;(H,6,7)/q+1;/p-1/t26-,29?;/m0./s1 |
| InChIKey | OKNUDSWGZPFQLV-PDVQBYMGSA-M |
| XLogP | 3.96 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|