C11H20NO4+ — CID 87064033
diethyl 1-methylpyrrolidin-1-ium-1,2-dicarboxylate (PubChem CID 87064033) has the molecular formula C11H20NO4+ and a molecular weight of 230.28 g/mol. Its IUPAC name is diethyl 1-methylpyrrolidin-1-ium-1,2-dicarboxylate.
| Compound Name | diethyl 1-methylpyrrolidin-1-ium-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87064033 |
| Molecular Formula | C11H20NO4+ |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | diethyl 1-methylpyrrolidin-1-ium-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CCC[N+]1(C)C(=O)OCC |
| InChI | InChI=1S/C11H20NO4/c1-4-15-10(13)9-7-6-8-12(9,3)11(14)16-5-2/h9H,4-8H2,1-3H3/q+1 |
| InChIKey | NFZNANJWASUEDU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|