C14H27N2O2+ — CID 67421477
tert-butyl (2R)-2-methyl-1-[(3R)-pyrrolidin-3-yl]pyrrolidin-1-ium-1-carboxylate (PubChem CID 67421477) has the molecular formula C14H27N2O2+ and a molecular weight of 255.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-1-[(3R)-pyrrolidin-3-yl]pyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-1-[(3R)-pyrrolidin-3-yl]pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67421477 |
| Molecular Formula | C14H27N2O2+ |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | tert-butyl (2R)-2-methyl-1-[(3R)-pyrrolidin-3-yl]pyrrolidin-1-ium-1-carboxylate |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)OC(C)(C)C)[C@@H]1CCNC1 |
| InChI | InChI=1S/C14H27N2O2/c1-11-6-5-9-16(11,12-7-8-15-10-12)13(17)18-14(2,3)4/h11-12,15H,5-10H2,1-4H3/q+1/t11-,12-,16?/m1/s1 |
| InChIKey | JWSWFHLOOHDAGQ-RJKRMVDRSA-N |
| XLogP | 2.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|