C25H31FN3O+ — CID 68733287
(E)-3-(3-fluorophenyl)-N-[3-methyl-4-(2-methyl-1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)phenyl]prop-2-enamide (PubChem CID 68733287) has the molecular formula C25H31FN3O+ and a molecular weight of 408.54 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[3-methyl-4-(2-methyl-1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[3-methyl-4-(2-methyl-1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68733287 |
| Molecular Formula | C25H31FN3O+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[3-methyl-4-(2-methyl-1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cccc(F)c2)ccc1[N+]1(C2CCNC2)CCCC1C |
| InChI | InChI=1S/C25H30FN3O/c1-18-15-22(28-25(30)11-8-20-6-3-7-21(26)16-20)9-10-24(18)29(14-4-5-19(29)2)23-12-13-27-17-23/h3,6-11,15-16,19,23,27H,4-5,12-14,17H2,1-2H3/p+1/b11-8+ |
| InChIKey | XEYUFSMWVIHHGY-DHZHZOJOSA-O |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|