C27H34ClF3N3O4+ — CID 91550469
tert-butyl (2R)-1-[[5-chloro-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]phenyl]methylcarbamoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 91550469) has the molecular formula C27H34ClF3N3O4+ and a molecular weight of 557.03 g/mol. Its IUPAC name is tert-butyl (2R)-1-[[5-chloro-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]phenyl]methylcarbamoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-1-[[5-chloro-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]phenyl]methylcarbamoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 91550469 |
| Molecular Formula | C27H34ClF3N3O4+ |
| Molecular Weight | 557.03 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | tert-butyl (2R)-1-[[5-chloro-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]phenyl]methylcarbamoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COc1ccc(NC(c2ccc(Cl)cc2CNC(=O)[N+]2(C(=O)OC(C)(C)C)CCC[C@H]2C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H33ClF3N3O4/c1-17-7-6-14-34(17,25(36)38-26(2,3)4)24(35)32-16-18-15-19(28)8-13-22(18)23(27(29,30)31)33-20-9-11-21(37-5)12-10-20/h8-13,15,17,23,33H,6-7,14,16H2,1-5H3/p+1/t17-,23?,34?/m1/s1 |
| InChIKey | XBAAQOJOQMFWLU-WHDGKZABSA-O |
| XLogP | 7.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.03 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|