C27H34ClF2N3O4 — CID 70072322
tert-butyl (2S)-2-carbamoyl-1-[[5-chloro-2-[3,3-difluoro-2-(4-methoxyanilino)propyl]phenyl]methyl]pyrrolidine-2-carboxylate (PubChem CID 70072322) has the molecular formula C27H34ClF2N3O4 and a molecular weight of 538.04 g/mol. Its IUPAC name is tert-butyl (2S)-2-carbamoyl-1-[[5-chloro-2-[3,3-difluoro-2-(4-methoxyanilino)propyl]phenyl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-2-carbamoyl-1-[[5-chloro-2-[3,3-difluoro-2-(4-methoxyanilino)propyl]phenyl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70072322 |
| Molecular Formula | C27H34ClF2N3O4 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | tert-butyl (2S)-2-carbamoyl-1-[[5-chloro-2-[3,3-difluoro-2-(4-methoxyanilino)propyl]phenyl]methyl]pyrrolidine-2-carboxylate |
| SMILES | COc1ccc(NC(Cc2ccc(Cl)cc2CN2CCC[C@]2(C(N)=O)C(=O)OC(C)(C)C)C(F)F)cc1 |
| InChI | InChI=1S/C27H34ClF2N3O4/c1-26(2,3)37-25(35)27(24(31)34)12-5-13-33(27)16-18-14-19(28)7-6-17(18)15-22(23(29)30)32-20-8-10-21(36-4)11-9-20/h6-11,14,22-23,32H,5,12-13,15-16H2,1-4H3,(H2,31,34)/t22?,27-/m0/s1 |
| InChIKey | FQKKBYNVCMVYTO-ZUILJJEPSA-N |
| XLogP | 4.80 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|