C24H35N4O6+ — CID 90714141
(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[(4-methoxyphenyl)carbamoyl]-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 90714141) has the molecular formula C24H35N4O6+ and a molecular weight of 475.57 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[(4-methoxyphenyl)carbamoyl]-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[(4-methoxyphenyl)carbamoyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 90714141 |
| Molecular Formula | C24H35N4O6+ |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[(4-methoxyphenyl)carbamoyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | COc1ccc(NC(=O)NC(=O)[N+]2(C(=O)[C@H](CC3CCCC3)CN(O)C=O)CCC[C@H]2C)cc1 |
| InChI | InChI=1S/C24H34N4O6/c1-17-6-5-13-28(17,22(30)19(15-27(33)16-29)14-18-7-3-4-8-18)24(32)26-23(31)25-20-9-11-21(34-2)12-10-20/h9-12,16-19,33H,3-8,13-15H2,1-2H3,(H-,25,26,31,32)/p+1/t17-,19-,28?/m1/s1 |
| InChIKey | POQDFHGCFICSBK-QJJZCCJWSA-O |
| XLogP | 3.51 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|