C24H31N4O5+ — CID 90888896
(2R)-N-(3-cyanobenzoyl)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 90888896) has the molecular formula C24H31N4O5+ and a molecular weight of 455.54 g/mol. Its IUPAC name is (2R)-N-(3-cyanobenzoyl)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-N-(3-cyanobenzoyl)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 90888896 |
| Molecular Formula | C24H31N4O5+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (2R)-N-(3-cyanobenzoyl)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NC(=O)c1cccc(C#N)c1)C(=O)[C@H](CC1CCCC1)CN(O)C=O |
| InChI | InChI=1S/C24H30N4O5/c1-17-6-5-11-28(17,24(32)26-22(30)20-10-4-9-19(13-20)14-25)23(31)21(15-27(33)16-29)12-18-7-2-3-8-18/h4,9-10,13,16-18,21,33H,2-3,5-8,11-12,15H2,1H3/p+1/t17-,21-,28?/m1/s1 |
| InChIKey | AXGJSNAZHHCNDO-IVVREGMNSA-O |
| XLogP | 2.98 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|