C22H37N4O6+ — CID 91014707
(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(oxolan-2-ylmethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 91014707) has the molecular formula C22H37N4O6+ and a molecular weight of 453.56 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(oxolan-2-ylmethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(oxolan-2-ylmethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91014707 |
| Molecular Formula | C22H37N4O6+ |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(oxolan-2-ylmethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NC(=O)NCC1CCCO1)C(=O)[C@H](CC1CCCC1)CN(O)C=O |
| InChI | InChI=1S/C22H36N4O6/c1-16-6-4-10-26(16,22(30)24-21(29)23-13-19-9-5-11-32-19)20(28)18(14-25(31)15-27)12-17-7-2-3-8-17/h15-19,31H,2-14H2,1H3,(H-,23,24,29,30)/p+1/t16-,18-,19?,26?/m1/s1 |
| InChIKey | OYQXXIMYWHZMBV-LWZJTPRSSA-O |
| XLogP | 2.15 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|