C21H36N3O5+ — CID 90717324
(2R)-1-[(2S)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(3-methylbutanoyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 90717324) has the molecular formula C21H36N3O5+ and a molecular weight of 410.54 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(3-methylbutanoyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[(2S)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(3-methylbutanoyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 90717324 |
| Molecular Formula | C21H36N3O5+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (2R)-1-[(2S)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(3-methylbutanoyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | CC(C)CC(=O)NC(=O)[N+]1(C(=O)[C@@H](CC2CCCC2)CN(O)C=O)CCC[C@H]1C |
| InChI | InChI=1S/C21H35N3O5/c1-15(2)11-19(26)22-21(28)24(10-6-7-16(24)3)20(27)18(13-23(29)14-25)12-17-8-4-5-9-17/h14-18,29H,4-13H2,1-3H3/p+1/t16-,18+,24?/m1/s1 |
| InChIKey | NVTQWVLBNUMVFH-AHRLYPMVSA-O |
| XLogP | 2.84 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|