C23H34N5O5+ — CID 87354103
(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-1-N-(2-pyridin-3-ylethyl)pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87354103) has the molecular formula C23H34N5O5+ and a molecular weight of 460.56 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-1-N-(2-pyridin-3-ylethyl)pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-1-N-(2-pyridin-3-ylethyl)pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87354103 |
| Molecular Formula | C23H34N5O5+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-1-N-(2-pyridin-3-ylethyl)pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCC[N+]1(C(=O)NCCc1cccnc1)C(=O)[C@H](CC1CCCC1)CN(O)C=O |
| InChI | InChI=1S/C23H33N5O5/c24-21(30)20-8-4-12-28(20,23(32)26-11-9-18-7-3-10-25-14-18)22(31)19(15-27(33)16-29)13-17-5-1-2-6-17/h3,7,10,14,16-17,19-20,33H,1-2,4-6,8-9,11-13,15H2,(H2-,24,26,30,32)/p+1/t19-,20+,28?/m1/s1 |
| InChIKey | IKQBHIJNERSUED-FARGSTTKSA-O |
| XLogP | 1.37 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|