C24H36N5O5+ — CID 91531824
(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(2-pyridin-3-ylethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 91531824) has the molecular formula C24H36N5O5+ and a molecular weight of 474.58 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(2-pyridin-3-ylethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(2-pyridin-3-ylethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91531824 |
| Molecular Formula | C24H36N5O5+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2-methyl-N-(2-pyridin-3-ylethylcarbamoyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NC(=O)NCCc1cccnc1)C(=O)[C@H](CC1CCCC1)CN(O)C=O |
| InChI | InChI=1S/C24H35N5O5/c1-18-6-5-13-29(18,22(31)21(16-28(34)17-30)14-19-7-2-3-8-19)24(33)27-23(32)26-12-10-20-9-4-11-25-15-20/h4,9,11,15,17-19,21,34H,2-3,5-8,10,12-14,16H2,1H3,(H-,26,27,32,33)/p+1/t18-,21-,29?/m1/s1 |
| InChIKey | JGVYBJHYDICESG-KGBXXKACSA-O |
| XLogP | 2.61 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|