C22H38N3O7+ — CID 87353987
[(2S)-1-methoxypropan-2-yl] (2S)-2-carbamoyl-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-3,3-dimethylpyrrolidin-1-ium-1-carboxylate (PubChem CID 87353987) has the molecular formula C22H38N3O7+ and a molecular weight of 456.56 g/mol. Its IUPAC name is [(2S)-1-methoxypropan-2-yl] (2S)-2-carbamoyl-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-3,3-dimethylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | [(2S)-1-methoxypropan-2-yl] (2S)-2-carbamoyl-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-3,3-dimethylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87353987 |
| Molecular Formula | C22H38N3O7+ |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | [(2S)-1-methoxypropan-2-yl] (2S)-2-carbamoyl-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-3,3-dimethylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COC[C@H](C)OC(=O)[N+]1(C(=O)[C@H](CC2CCCC2)CN(O)C=O)CCC(C)(C)[C@H]1C(N)=O |
| InChI | InChI=1S/C22H37N3O7/c1-15(13-31-4)32-21(29)25(10-9-22(2,3)18(25)19(23)27)20(28)17(12-24(30)14-26)11-16-7-5-6-8-16/h14-18,30H,5-13H2,1-4H3,(H-,23,27)/p+1/t15-,17+,18+,25?/m0/s1 |
| InChIKey | GVDSIFSEJFYESD-QPXBQTFWSA-O |
| XLogP | 1.83 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|