C23H40N3O7+ — CID 91309372
[(2S)-1-methoxypropan-2-yl] N-[(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2,3,3-trimethylpyrrolidin-1-ium-1-carbonyl]carbamate (PubChem CID 91309372) has the molecular formula C23H40N3O7+ and a molecular weight of 470.59 g/mol. Its IUPAC name is [(2S)-1-methoxypropan-2-yl] N-[(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2,3,3-trimethylpyrrolidin-1-ium-1-carbonyl]carbamate.
| Compound Name | [(2S)-1-methoxypropan-2-yl] N-[(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2,3,3-trimethylpyrrolidin-1-ium-1-carbonyl]carbamate |
|---|---|
| PubChem CID | 91309372 |
| Molecular Formula | C23H40N3O7+ |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | [(2S)-1-methoxypropan-2-yl] N-[(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-2,3,3-trimethylpyrrolidin-1-ium-1-carbonyl]carbamate |
| SMILES | COC[C@H](C)OC(=O)NC(=O)[N+]1(C(=O)[C@H](CC2CCCC2)CN(O)C=O)CCC(C)(C)[C@H]1C |
| InChI | InChI=1S/C23H39N3O7/c1-16(14-32-5)33-22(30)24-21(29)26(11-10-23(3,4)17(26)2)20(28)19(13-25(31)15-27)12-18-8-6-7-9-18/h15-19,31H,6-14H2,1-5H3/p+1/t16-,17+,19+,26?/m0/s1 |
| InChIKey | IMULUKLPZZMFLH-WUAUBAKMSA-O |
| XLogP | 3.07 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|