C21H24ClF2N3O2 — CID 70072196
(2S)-N-[[5-chloro-2-[2,2-difluoro-2-(4-methoxyanilino)ethyl]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 70072196) has the molecular formula C21H24ClF2N3O2 and a molecular weight of 423.89 g/mol. Its IUPAC name is (2S)-N-[[5-chloro-2-[2,2-difluoro-2-(4-methoxyanilino)ethyl]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[5-chloro-2-[2,2-difluoro-2-(4-methoxyanilino)ethyl]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70072196 |
| Molecular Formula | C21H24ClF2N3O2 |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (2S)-N-[[5-chloro-2-[2,2-difluoro-2-(4-methoxyanilino)ethyl]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(F)(F)Cc2ccc(Cl)cc2CNC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C21H24ClF2N3O2/c1-29-18-8-6-17(7-9-18)27-21(23,24)12-14-4-5-16(22)11-15(14)13-26-20(28)19-3-2-10-25-19/h4-9,11,19,25,27H,2-3,10,12-13H2,1H3,(H,26,28)/t19-/m0/s1 |
| InChIKey | LNSWKKNEIWGVSH-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|