C14H16F4N2O3 — CID 84588646
(2S)-N-[[2,4-bis(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 84588646) has the molecular formula C14H16F4N2O3 and a molecular weight of 336.29 g/mol. Its IUPAC name is (2S)-N-[[2,4-bis(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[2,4-bis(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 84588646 |
| Molecular Formula | C14H16F4N2O3 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-N-[[2,4-bis(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1OC(F)F)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H16F4N2O3/c15-13(16)22-9-4-3-8(11(6-9)23-14(17)18)7-20-12(21)10-2-1-5-19-10/h3-4,6,10,13-14,19H,1-2,5,7H2,(H,20,21)/t10-/m0/s1 |
| InChIKey | WISHLFDHLZGEGL-JTQLQIEISA-N |
| XLogP | 2.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |