C13H16F2N2O2 — CID 61252076
(2S)-N-[[2-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 61252076) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S)-N-[[2-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[2-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61252076 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S)-N-[[2-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-13(15)19-11-6-2-1-4-9(11)8-17-12(18)10-5-3-7-16-10/h1-2,4,6,10,13,16H,3,5,7-8H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | VMWFVAOPMRRZPA-JTQLQIEISA-N |
| XLogP | 1.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |