C12H22NO5+ — CID 57287398
1-O'-tert-butyl 1-O-methyl (1S,2R,3R)-3-hydroxy-2-methylpyrrolidin-1-ium-1,1-dicarboxylate (PubChem CID 57287398) has the molecular formula C12H22NO5+ and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-methyl (1S,2R,3R)-3-hydroxy-2-methylpyrrolidin-1-ium-1,1-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-methyl (1S,2R,3R)-3-hydroxy-2-methylpyrrolidin-1-ium-1,1-dicarboxylate |
|---|---|
| PubChem CID | 57287398 |
| Molecular Formula | C12H22NO5+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-O'-tert-butyl 1-O-methyl (1S,2R,3R)-3-hydroxy-2-methylpyrrolidin-1-ium-1,1-dicarboxylate |
| SMILES | COC(=O)[N@+]1(C(=O)OC(C)(C)C)CC[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C12H22NO5/c1-8-9(14)6-7-13(8,10(15)17-5)11(16)18-12(2,3)4/h8-9,14H,6-7H2,1-5H3/q+1/t8-,9-,13+/m1/s1 |
| InChIKey | XLKKZESFRMWFQF-KKFJDGPESA-N |
| XLogP | 1.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|