C14H27N2O4+ — CID 54525043
tert-butyl (2S)-1-tert-butyl-2-carbamoyl-3-hydroxypyrrolidin-1-ium-1-carboxylate (PubChem CID 54525043) has the molecular formula C14H27N2O4+ and a molecular weight of 287.38 g/mol. Its IUPAC name is tert-butyl (2S)-1-tert-butyl-2-carbamoyl-3-hydroxypyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2S)-1-tert-butyl-2-carbamoyl-3-hydroxypyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 54525043 |
| Molecular Formula | C14H27N2O4+ |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | tert-butyl (2S)-1-tert-butyl-2-carbamoyl-3-hydroxypyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(C)(C)C)CCC(O)[C@H]1C(N)=O |
| InChI | InChI=1S/C14H26N2O4/c1-13(2,3)16(12(19)20-14(4,5)6)8-7-9(17)10(16)11(15)18/h9-10,17H,7-8H2,1-6H3,(H-,15,18)/p+1/t9?,10-,16?/m0/s1 |
| InChIKey | HXVRNCRISMLKDV-MAXPVNGDSA-O |
| XLogP | 1.16 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|