C13H19F3NO4S+ — CID 56996633
(2R)-2-methyl-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56996633) has the molecular formula C13H19F3NO4S+ and a molecular weight of 342.36 g/mol. Its IUPAC name is (2R)-2-methyl-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56996633 |
| Molecular Formula | C13H19F3NO4S+ |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2R)-2-methyl-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCC(=O)SCC(C(=O)[N+]1(C(=O)O)CCC[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO4S/c1-3-10(18)22-7-9(13(14,15)16)11(19)17(12(20)21)6-4-5-8(17)2/h8-9H,3-7H2,1-2H3/p+1/t8-,9?,17?/m1/s1 |
| InChIKey | FDLYIZSLIDJLLF-LOWPREMFSA-O |
| XLogP | 3.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|