C10H16F2NO3S+ — CID 57140333
(2R)-4,4-difluoro-2-methyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57140333) has the molecular formula C10H16F2NO3S+ and a molecular weight of 268.30 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-methyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-4,4-difluoro-2-methyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57140333 |
| Molecular Formula | C10H16F2NO3S+ |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (2R)-4,4-difluoro-2-methyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(S)CC(=O)[N+]1(C(=O)O)CC(F)(F)C[C@H]1C |
| InChI | InChI=1S/C10H15F2NO3S/c1-6-4-10(11,12)5-13(6,9(15)16)8(14)3-7(2)17/h6-7H,3-5H2,1-2H3,(H-,15,16,17)/p+1/t6-,7?,13?/m1/s1 |
| InChIKey | XSDFHNDMZLECLR-CLRFWONCSA-O |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|