C11H15F3NO4S+ — CID 57090951
(2R)-1-(2-acetylsulfanyl-3,3,3-trifluoropropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57090951) has the molecular formula C11H15F3NO4S+ and a molecular weight of 314.31 g/mol. Its IUPAC name is (2R)-1-(2-acetylsulfanyl-3,3,3-trifluoropropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(2-acetylsulfanyl-3,3,3-trifluoropropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57090951 |
| Molecular Formula | C11H15F3NO4S+ |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2R)-1-(2-acetylsulfanyl-3,3,3-trifluoropropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SC(C(=O)[N+]1(C(=O)O)CCC[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO4S/c1-6-4-3-5-15(6,10(18)19)9(17)8(11(12,13)14)20-7(2)16/h6,8H,3-5H2,1-2H3/p+1/t6-,8?,15?/m1/s1 |
| InChIKey | VSOVGWVSFFKBLF-GBPCDLHVSA-O |
| XLogP | 2.40 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|