C12H21N2O4S+ — CID 57048152
(2R)-1-[2-(acetylsulfanylmethyl)-3-aminopropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57048152) has the molecular formula C12H21N2O4S+ and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-1-[2-(acetylsulfanylmethyl)-3-aminopropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(acetylsulfanylmethyl)-3-aminopropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57048152 |
| Molecular Formula | C12H21N2O4S+ |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (2R)-1-[2-(acetylsulfanylmethyl)-3-aminopropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(CN)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C12H20N2O4S/c1-8-4-3-5-14(8,12(17)18)11(16)10(6-13)7-19-9(2)15/h8,10H,3-7,13H2,1-2H3/p+1/t8-,10?,14?/m1/s1 |
| InChIKey | LHBSIJGUOPJMBB-CCMBEOLZSA-O |
| XLogP | 1.04 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|