C14H22NO5S2+ — CID 57238251
(2R)-1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57238251) has the molecular formula C14H22NO5S2+ and a molecular weight of 348.47 g/mol. Its IUPAC name is (2R)-1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57238251 |
| Molecular Formula | C14H22NO5S2+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2R)-1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(CSC(C)=O)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C14H21NO5S2/c1-9-5-4-6-15(9,14(19)20)13(18)12(7-21-10(2)16)8-22-11(3)17/h9,12H,4-8H2,1-3H3/p+1/t9-,15?/m1/s1 |
| InChIKey | KMMFEYYMDOARJC-WXMRUQJCSA-O |
| XLogP | 2.37 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|