C14H22NO4S+ — CID 57061431
(2R)-1-(2-acetylsulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57061431) has the molecular formula C14H22NO4S+ and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R)-1-(2-acetylsulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(2-acetylsulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57061431 |
| Molecular Formula | C14H22NO4S+ |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2R)-1-(2-acetylsulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SC1CCCC1C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C14H21NO4S/c1-9-5-4-8-15(9,14(18)19)13(17)11-6-3-7-12(11)20-10(2)16/h9,11-12H,3-8H2,1-2H3/p+1/t9-,11?,12?,15?/m1/s1 |
| InChIKey | VREIRPLEIBXEOH-WEKLGNRTSA-O |
| XLogP | 2.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|