C15H24NO4S+ — CID 57222954
(2R)-1-(2-acetylsulfanylcyclohexanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57222954) has the molecular formula C15H24NO4S+ and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R)-1-(2-acetylsulfanylcyclohexanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(2-acetylsulfanylcyclohexanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57222954 |
| Molecular Formula | C15H24NO4S+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2R)-1-(2-acetylsulfanylcyclohexanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SC1CCCCC1C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C15H23NO4S/c1-10-6-5-9-16(10,15(19)20)14(18)12-7-3-4-8-13(12)21-11(2)17/h10,12-13H,3-9H2,1-2H3/p+1/t10-,12?,13?,16?/m1/s1 |
| InChIKey | DYLYVLKDQDHHFA-ZJMBPCIDSA-O |
| XLogP | 3.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|