C13H20NO5S2+ — CID 57019620
(2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57019620) has the molecular formula C13H20NO5S2+ and a molecular weight of 334.44 g/mol. Its IUPAC name is (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57019620 |
| Molecular Formula | C13H20NO5S2+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(SC(C)=O)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C13H19NO5S2/c1-8-5-4-6-14(8,13(18)19)12(17)11(21-10(3)16)7-20-9(2)15/h8,11H,4-7H2,1-3H3/p+1/t8-,11?,14?/m1/s1 |
| InChIKey | QWPXSAABHONCHG-UGHMMHLFSA-O |
| XLogP | 2.12 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|