C15H24NO3S2+ — CID 57068553
(1R,2R,4R)-2-methyl-4-pent-4-ynylsulfanyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57068553) has the molecular formula C15H24NO3S2+ and a molecular weight of 330.50 g/mol. Its IUPAC name is (1R,2R,4R)-2-methyl-4-pent-4-ynylsulfanyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-2-methyl-4-pent-4-ynylsulfanyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57068553 |
| Molecular Formula | C15H24NO3S2+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (1R,2R,4R)-2-methyl-4-pent-4-ynylsulfanyl-1-(3-sulfanylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C#CCCCS[C@@H]1C[C@@H](C)[N@@+](C(=O)O)(C(=O)CC(C)S)C1 |
| InChI | InChI=1S/C15H23NO3S2/c1-4-5-6-7-21-13-8-11(2)16(10-13,15(18)19)14(17)9-12(3)20/h1,11-13H,5-10H2,2-3H3,(H-,18,19,20)/p+1/t11-,12?,13-,16-/m1/s1 |
| InChIKey | MLXZKLJUOJZICJ-JRIQMUAPSA-O |
| XLogP | 3.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|