C13H22NO4S2+ — CID 57297453
(2R)-1-[2-(acetylsulfanylmethyl)-3-methylsulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57297453) has the molecular formula C13H22NO4S2+ and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R)-1-[2-(acetylsulfanylmethyl)-3-methylsulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(acetylsulfanylmethyl)-3-methylsulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57297453 |
| Molecular Formula | C13H22NO4S2+ |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2R)-1-[2-(acetylsulfanylmethyl)-3-methylsulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CSCC(CSC(C)=O)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C13H21NO4S2/c1-9-5-4-6-14(9,13(17)18)12(16)11(7-19-3)8-20-10(2)15/h9,11H,4-8H2,1-3H3/p+1/t9-,11?,14?/m1/s1 |
| InChIKey | DTOCWEJUZRWGTD-FDMSEYEVSA-O |
| XLogP | 2.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|