C13H20NO3S+ — CID 57214797
(1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57214797) has the molecular formula C13H20NO3S+ and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57214797 |
| Molecular Formula | C13H20NO3S+ |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C#CCCCS[C@@H]1C[C@@H](C)[N@+](C(C)=O)(C(=O)O)C1 |
| InChI | InChI=1S/C13H19NO3S/c1-4-5-6-7-18-12-8-10(2)14(9-12,11(3)15)13(16)17/h1,10,12H,5-9H2,2-3H3/p+1/t10-,12-,14-/m1/s1 |
| InChIKey | MQFNIUUCLIASIY-MPKXVKKWSA-O |
| XLogP | 2.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|