C13H22NO3S2+ — CID 57170374
(2R)-1-(3-acetylsulfanylpentanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57170374) has the molecular formula C13H22NO3S2+ and a molecular weight of 304.46 g/mol. Its IUPAC name is (2R)-1-(3-acetylsulfanylpentanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(3-acetylsulfanylpentanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57170374 |
| Molecular Formula | C13H22NO3S2+ |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (2R)-1-(3-acetylsulfanylpentanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCC(CC(=S)[N+]1(C(=O)O)CCC[C@H]1C)SC(C)=O |
| InChI | InChI=1S/C13H21NO3S2/c1-4-11(19-10(3)15)8-12(18)14(13(16)17)7-5-6-9(14)2/h9,11H,4-8H2,1-3H3/p+1/t9-,11?,14?/m1/s1 |
| InChIKey | DJJFDSULPNLWTL-FDMSEYEVSA-O |
| XLogP | 3.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|