C18H26NO3S+ — CID 57033914
pent-4-ynyl (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57033914) has the molecular formula C18H26NO3S+ and a molecular weight of 336.48 g/mol. Its IUPAC name is pent-4-ynyl (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | pent-4-ynyl (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57033914 |
| Molecular Formula | C18H26NO3S+ |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | pent-4-ynyl (1R,2R,4R)-1-acetyl-2-methyl-4-pent-4-ynylsulfanylpyrrolidin-1-ium-1-carboxylate |
| SMILES | C#CCCCOC(=O)[N@+]1(C(C)=O)C[C@H](SCCCC#C)C[C@H]1C |
| InChI | InChI=1S/C18H26NO3S/c1-5-7-9-11-22-18(21)19(16(4)20)14-17(13-15(19)3)23-12-10-8-6-2/h1-2,15,17H,7-14H2,3-4H3/q+1/t15-,17-,19-/m1/s1 |
| InChIKey | BINLMEVOOVHSOJ-SZVBFZGTSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|