C12H20NO3S2+ — CID 57228314
(1S)-1-(3-ethanethioylsulfanyl-2-methylpropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57228314) has the molecular formula C12H20NO3S2+ and a molecular weight of 290.43 g/mol. Its IUPAC name is (1S)-1-(3-ethanethioylsulfanyl-2-methylpropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S)-1-(3-ethanethioylsulfanyl-2-methylpropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57228314 |
| Molecular Formula | C12H20NO3S2+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S)-1-(3-ethanethioylsulfanyl-2-methylpropanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=S)SCC(C)C(=O)[N@+]1(C(=O)O)CCCC1C |
| InChI | InChI=1S/C12H19NO3S2/c1-8(7-18-10(3)17)11(14)13(12(15)16)6-4-5-9(13)2/h8-9H,4-7H2,1-3H3/p+1/t8?,9?,13-/m0/s1 |
| InChIKey | WXMGDNFSNJRHTA-RPTIHFLNSA-O |
| XLogP | 2.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|