C12H20NO4S+ — CID 90891318
(2S)-1-(4-acetylsulfanylbutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 90891318) has the molecular formula C12H20NO4S+ and a molecular weight of 274.36 g/mol. Its IUPAC name is (2S)-1-(4-acetylsulfanylbutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2S)-1-(4-acetylsulfanylbutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 90891318 |
| Molecular Formula | C12H20NO4S+ |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2S)-1-(4-acetylsulfanylbutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCCCC(=O)[N+]1(C(=O)O)CCC[C@@H]1C |
| InChI | InChI=1S/C12H19NO4S/c1-9-5-3-7-13(9,12(16)17)11(15)6-4-8-18-10(2)14/h9H,3-8H2,1-2H3/p+1/t9-,13?/m0/s1 |
| InChIKey | MNHPYFHXMVPMOJ-LLTODGECSA-O |
| XLogP | 2.25 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|