C9H16NO3S2+ — CID 57272606
(2R)-1-[2,3-bis(sulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57272606) has the molecular formula C9H16NO3S2+ and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R)-1-[2,3-bis(sulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2,3-bis(sulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57272606 |
| Molecular Formula | C9H16NO3S2+ |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2R)-1-[2,3-bis(sulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(S)CS |
| InChI | InChI=1S/C9H15NO3S2/c1-6-3-2-4-10(6,9(12)13)8(11)7(15)5-14/h6-7H,2-5H2,1H3,(H2-,12,13,14,15)/p+1/t6-,7?,10?/m1/s1 |
| InChIKey | RRPPUINMPIABGV-AFKSGGFBSA-O |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|