C11H18NO5S+ — CID 57023757
(2R)-1-[2-(carboxymethyl)-3-sulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57023757) has the molecular formula C11H18NO5S+ and a molecular weight of 276.33 g/mol. Its IUPAC name is (2R)-1-[2-(carboxymethyl)-3-sulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(carboxymethyl)-3-sulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57023757 |
| Molecular Formula | C11H18NO5S+ |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (2R)-1-[2-(carboxymethyl)-3-sulfanylpropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(CS)CC(=O)O |
| InChI | InChI=1S/C11H17NO5S/c1-7-3-2-4-12(7,11(16)17)10(15)8(6-18)5-9(13)14/h7-8H,2-6H2,1H3,(H2-,13,14,16,17,18)/p+1/t7-,8?,12?/m1/s1 |
| InChIKey | ORJGNFJXWHCSGP-OQNPIJIBSA-O |
| XLogP | 1.21 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|