C19H29N2O3+ — CID 57018676
tert-butyl (2R)-2-methyl-1-(2-phenylethylcarbamoyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 57018676) has the molecular formula C19H29N2O3+ and a molecular weight of 333.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-1-(2-phenylethylcarbamoyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-1-(2-phenylethylcarbamoyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57018676 |
| Molecular Formula | C19H29N2O3+ |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | tert-butyl (2R)-2-methyl-1-(2-phenylethylcarbamoyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NCCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-15-9-8-14-21(15,18(23)24-19(2,3)4)17(22)20-13-12-16-10-6-5-7-11-16/h5-7,10-11,15H,8-9,12-14H2,1-4H3/p+1/t15-,21?/m1/s1 |
| InChIKey | VDAUFEJFNNVALO-RBFZIWAESA-O |
| XLogP | 3.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|