C19H25N3O4 — CID 4876963
2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 4876963) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 4876963 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)NC(C)CCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H25N3O4/c1-13(2)11-21-17(24)18(25)22(19(21)26)12-16(23)20-14(3)9-10-15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3,(H,20,23) |
| InChIKey | YWWTVNCCFYPBHF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|