C22H22N4O3 — CID 57025025
5-[(1R,2R,3S)-3-(1,3-benzodioxol-5-yl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 57025025) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-[(1R,2R,3S)-3-(1,3-benzodioxol-5-yl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(1R,2R,3S)-3-(1,3-benzodioxol-5-yl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 57025025 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[(1R,2R,3S)-3-(1,3-benzodioxol-5-yl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | CN1C2CC[C@@H]1[C@H](c1nc(-c3ccncc3)no1)[C@@H](c1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C22H22N4O3/c1-26-15-3-4-17(26)20(22-24-21(25-29-22)13-6-8-23-9-7-13)16(11-15)14-2-5-18-19(10-14)28-12-27-18/h2,5-10,15-17,20H,3-4,11-12H2,1H3/t15?,16-,17-,20-/m1/s1 |
| InChIKey | OGPWEVXIBHMDHV-RXKHTKJTSA-N |
| XLogP | 3.59 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |