C12H24O3S6 — CID 57029044
3-[[4,6-bis(3-sulfanylpropylsulfanyl)-1,3,5-trioxan-2-yl]sulfanyl]propane-1-thiol (PubChem CID 57029044) has the molecular formula C12H24O3S6 and a molecular weight of 408.72 g/mol. Its IUPAC name is 3-[[4,6-bis(3-sulfanylpropylsulfanyl)-1,3,5-trioxan-2-yl]sulfanyl]propane-1-thiol.
| Compound Name | 3-[[4,6-bis(3-sulfanylpropylsulfanyl)-1,3,5-trioxan-2-yl]sulfanyl]propane-1-thiol |
|---|---|
| PubChem CID | 57029044 |
| Molecular Formula | C12H24O3S6 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 3-[[4,6-bis(3-sulfanylpropylsulfanyl)-1,3,5-trioxan-2-yl]sulfanyl]propane-1-thiol |
| SMILES | SCCCSC1OC(SCCCS)OC(SCCCS)O1 |
| InChI | InChI=1S/C12H24O3S6/c16-4-1-7-19-10-13-11(20-8-2-5-17)15-12(14-10)21-9-3-6-18/h10-12,16-18H,1-9H2 |
| InChIKey | CBPGMBZVRRIBKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|