C23H29ClO4 — CID 57029074
[(8R,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] 2-chloroacetate (PubChem CID 57029074) has the molecular formula C23H29ClO4 and a molecular weight of 404.93 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] 2-chloroacetate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 57029074 |
| Molecular Formula | C23H29ClO4 |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] 2-chloroacetate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC(OC(=O)CCl)[C@]12C |
| InChI | InChI=1S/C23H29ClO4/c1-13(25)17-6-7-18-16-5-4-14-10-15(26)8-9-22(14,2)19(16)11-20(23(17,18)3)28-21(27)12-24/h8-10,16-20H,4-7,11-12H2,1-3H3/t16-,17+,18-,19-,20?,22-,23+/m0/s1 |
| InChIKey | LJJHADHDGMZNSW-YSJSPIKWSA-N |
| XLogP | 4.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|