About 4-butan-2-yloctan-1-ol
4-butan-2-yloctan-1-ol (PubChem CID 57029732) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 4-butan-2-yloctan-1-ol.
Molecular Properties
| Compound Name | 4-butan-2-yloctan-1-ol |
| PubChem CID | 57029732 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 4-butan-2-yloctan-1-ol |
| SMILES | CCCCC(CCCO)C(C)CC |
| InChI | InChI=1S/C12H26O/c1-4-6-8-12(9-7-10-13)11(3)5-2/h11-13H,4-10H2,1-3H3 |
| InChIKey | CYAITWBWKUTGHW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butan-2-yloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yloctan-1-ol?
The IUPAC name of 4-butan-2-yloctan-1-ol (CID 57029732) is 4-butan-2-yloctan-1-ol.
What is the SMILES notation for 4-butan-2-yloctan-1-ol?
The canonical SMILES for 4-butan-2-yloctan-1-ol is CCCCC(CCCO)C(C)CC.
What is the InChIKey of 4-butan-2-yloctan-1-ol?
The InChIKey is CYAITWBWKUTGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O/c1-4-6-8-12(9-7-10-13)11(3)5-2/h11-13H,4-10H2,1-3H3.
What are the key properties of 4-butan-2-yloctan-1-ol?
4-butan-2-yloctan-1-ol has a molecular weight of 186.34 g/mol, XLogP of 3.61, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yloctan-1-ol is sourced from PubChem (CID 57029732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).