C21H17NO4S2 — CID 57033587
5-methoxy-3,3-bis(4-sulfanyloxyphenyl)-1H-indol-2-one (PubChem CID 57033587) has the molecular formula C21H17NO4S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-methoxy-3,3-bis(4-sulfanyloxyphenyl)-1H-indol-2-one.
| Compound Name | 5-methoxy-3,3-bis(4-sulfanyloxyphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 57033587 |
| Molecular Formula | C21H17NO4S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 5-methoxy-3,3-bis(4-sulfanyloxyphenyl)-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)C(c1ccc(OS)cc1)(c1ccc(OS)cc1)C(=O)N2 |
| InChI | InChI=1S/C21H17NO4S2/c1-24-17-10-11-19-18(12-17)21(20(23)22-19,13-2-6-15(25-27)7-3-13)14-4-8-16(26-28)9-5-14/h2-12,27-28H,1H3,(H,22,23) |
| InChIKey | PKDBYWUDCSBTHY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|