C21H22ClN3O2S — CID 57033754
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]acetamide (PubChem CID 57033754) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 57033754 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccc(Cl)cc2)n1)NCCNCC(O)c1ccccc1 |
| InChI | InChI=1S/C21H22ClN3O2S/c22-17-8-6-16(7-9-17)21-25-18(14-28-21)12-20(27)24-11-10-23-13-19(26)15-4-2-1-3-5-15/h1-9,14,19,23,26H,10-13H2,(H,24,27) |
| InChIKey | FMYIARDPZBPLER-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|