C24H32ClFO5 — CID 57034383
(1S,2S,8S,9S,13R)-8-(2-chloroacetyl)-12-fluoro-14-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one (PubChem CID 57034383) has the molecular formula C24H32ClFO5 and a molecular weight of 454.97 g/mol. Its IUPAC name is (1S,2S,8S,9S,13R)-8-(2-chloroacetyl)-12-fluoro-14-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one.
| Compound Name | (1S,2S,8S,9S,13R)-8-(2-chloroacetyl)-12-fluoro-14-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
|---|---|
| PubChem CID | 57034383 |
| Molecular Formula | C24H32ClFO5 |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (1S,2S,8S,9S,13R)-8-(2-chloroacetyl)-12-fluoro-14-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
| SMILES | CC1(C)OC2C[C@H]3[C@@H]4CCC5=CC(=O)CC(O)[C@]5(C)C4(F)CC[C@]3(C)[C@]2(C(=O)CCl)O1 |
| InChI | InChI=1S/C24H32ClFO5/c1-20(2)30-19-11-16-15-6-5-13-9-14(27)10-17(28)22(13,4)23(15,26)8-7-21(16,3)24(19,31-20)18(29)12-25/h9,15-17,19,28H,5-8,10-12H2,1-4H3/t15-,16-,17?,19?,21-,22+,23?,24+/m0/s1 |
| InChIKey | PVFYMGVKLOGHPE-JUSCNUIDSA-N |
| XLogP | 3.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|