C24H31ClO4 — CID 22819653
(1S,2S,8S,9S,13S)-8-(2-chloroacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-11,17-dien-16-one (PubChem CID 22819653) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is (1S,2S,8S,9S,13S)-8-(2-chloroacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-11,17-dien-16-one.
| Compound Name | (1S,2S,8S,9S,13S)-8-(2-chloroacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-11,17-dien-16-one |
|---|---|
| PubChem CID | 22819653 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (1S,2S,8S,9S,13S)-8-(2-chloroacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-11,17-dien-16-one |
| SMILES | CC1(C)OC2C[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)C4=CC[C@]3(C)[C@]2(C(=O)CCl)O1 |
| InChI | InChI=1S/C24H31ClO4/c1-21(2)28-20-12-18-16-6-5-14-11-15(26)7-9-22(14,3)17(16)8-10-23(18,4)24(20,29-21)19(27)13-25/h8,11,16,18,20H,5-7,9-10,12-13H2,1-4H3/t16-,18+,20?,22+,23+,24-/m1/s1 |
| InChIKey | LSAJITRAEZCSBI-NYGCXXFGSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|