C20H23Br2FO2 — CID 57034467
(6R,8R,9S,10S,13S,14S)-6-bromo-6-(bromomethyl)-2-fluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57034467) has the molecular formula C20H23Br2FO2 and a molecular weight of 474.21 g/mol. Its IUPAC name is (6R,8R,9S,10S,13S,14S)-6-bromo-6-(bromomethyl)-2-fluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10S,13S,14S)-6-bromo-6-(bromomethyl)-2-fluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57034467 |
| Molecular Formula | C20H23Br2FO2 |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | (6R,8R,9S,10S,13S,14S)-6-bromo-6-(bromomethyl)-2-fluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C=C(F)C(=O)C=C1[C@@](Br)(CBr)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H23Br2FO2/c1-18-6-5-13-11(12(18)3-4-17(18)25)8-20(22,10-21)16-7-15(24)14(23)9-19(13,16)2/h7,9,11-13H,3-6,8,10H2,1-2H3/t11-,12-,13-,18-,19+,20-/m0/s1 |
| InChIKey | VPJDTVWUEIOSKE-GSQQTBPASA-N |
| XLogP | 5.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|