About piperazine-1-sulfinate
piperazine-1-sulfinate (PubChem CID 57034737) has the molecular formula C4H9N2O2S-
and a molecular weight of 149.19 g/mol. Its IUPAC name is piperazine-1-sulfinate.
Molecular Properties
| Compound Name | piperazine-1-sulfinate |
| PubChem CID | 57034737 |
| Molecular Formula | C4H9N2O2S- |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | piperazine-1-sulfinate |
| SMILES | O=S([O-])N1CCNCC1 |
| InChI | InChI=1S/C4H10N2O2S/c7-9(8)6-3-1-5-2-4-6/h5H,1-4H2,(H,7,8)/p-1 |
| InChIKey | ZEQROPBATTXRBA-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-sulfinate?
The IUPAC name of piperazine-1-sulfinate (CID 57034737) is piperazine-1-sulfinate.
What is the SMILES notation for piperazine-1-sulfinate?
The canonical SMILES for piperazine-1-sulfinate is O=S([O-])N1CCNCC1.
What is the InChIKey of piperazine-1-sulfinate?
The InChIKey is ZEQROPBATTXRBA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10N2O2S/c7-9(8)6-3-1-5-2-4-6/h5H,1-4H2,(H,7,8)/p-1.
What are the key properties of piperazine-1-sulfinate?
piperazine-1-sulfinate has a molecular weight of 149.19 g/mol, XLogP of -1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-sulfinate is sourced from PubChem (CID 57034737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).