C16H16ClNO — CID 57035214
(1Z)-5-chloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine (PubChem CID 57035214) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is (1Z)-5-chloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine.
| Compound Name | (1Z)-5-chloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
|---|---|
| PubChem CID | 57035214 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (1Z)-5-chloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
| SMILES | CNC1CC=c2cccc/c2=C2\C=CC(Cl)=CC2O1 |
| InChI | InChI=1S/C16H16ClNO/c1-18-16-9-6-11-4-2-3-5-13(11)14-8-7-12(17)10-15(14)19-16/h2-8,10,15-16,18H,9H2,1H3/b11-6?,14-13- |
| InChIKey | VKKGINIDHUZSTK-RJAVPJRDSA-N |
| XLogP | 1.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |