C16H15Cl2NO — CID 57144711
(1Z)-5,13-dichloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine (PubChem CID 57144711) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is (1Z)-5,13-dichloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine.
| Compound Name | (1Z)-5,13-dichloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
|---|---|
| PubChem CID | 57144711 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (1Z)-5,13-dichloro-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
| SMILES | CNC1CC=c2c(Cl)ccc/c2=C2\C=CC(Cl)=CC2O1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-19-16-8-7-12-11(3-2-4-14(12)18)13-6-5-10(17)9-15(13)20-16/h2-7,9,15-16,19H,8H2,1H3/b12-7?,13-11- |
| InChIKey | RPBWMXQXSIYFGX-RVEWSBHASA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |